EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO6 |
| Net Charge | -2 |
| Average Mass | 309.318 |
| Monoisotopic Mass | 309.12233 |
| SMILES | C/C(=C/C=C/[C@@H](C)C(=O)[O-])[C@H]1C[NH2+][C@H](C(=O)[O-])[C@H]1CC(=O)[O-] |
| InChI | InChI=1S/C15H21NO6/c1-8(4-3-5-9(2)14(19)20)11-7-16-13(15(21)22)10(11)6-12(17)18/h3-5,9-11,13,16H,6-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)/p-2/b5-3+,8-4-/t9-,10+,11-,13+/m1/s1 |
| InChIKey | VZFRNCSOCOPNDB-AOKDLOFSSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| domoate(2−) (CHEBI:167470) is a tricarboxylic acid anion (CHEBI:35753) |
| domoate(2−) (CHEBI:167470) is conjugate base of domoic acid (CHEBI:34727) |
| Incoming Relation(s) |
| domoic acid (CHEBI:34727) is conjugate acid of domoate(2−) (CHEBI:167470) |
| IUPAC Name |
|---|
| (2S,3S,4S)-4-[(2Z,4E,6R)-6-carboxylatohepta-2,4-dien-2-yl]-3-(carboxylatomethyl)pyrrolidinium-2-carboxylate |
| UniProt Name | Source |
|---|---|
| domoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-18737 | MetaCyc |
| Citations |
|---|