EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22NO.C7H5O3 |
| Net Charge | 0 |
| Average Mass | 393.483 |
| Monoisotopic Mass | 393.19401 |
| SMILES | C[NH+](C)CCOC(c1ccccc1)c1ccccc1.O=C([O-])c1ccccc1O |
| InChI | InChI=1S/C17H21NO.C7H6O3/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;8-6-4-2-1-3-5(6)7(9)10/h3-12,17H,13-14H2,1-2H3;1-4,8H,(H,9,10) |
| InChIKey | RTSZUSOHOIFYSY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-allergic agent A drug used to treat allergic reactions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenhydramine salicylate (CHEBI:34720) has part diphenhydramine (CHEBI:4636) |
| diphenhydramine salicylate (CHEBI:34720) has part salicylate (CHEBI:30762) |
| diphenhydramine salicylate (CHEBI:34720) has role anti-allergic agent (CHEBI:50857) |
| diphenhydramine salicylate (CHEBI:34720) has role antiemetic (CHEBI:50919) |
| diphenhydramine salicylate (CHEBI:34720) has role H1-receptor antagonist (CHEBI:37955) |
| diphenhydramine salicylate (CHEBI:34720) has role muscarinic antagonist (CHEBI:48876) |
| diphenhydramine salicylate (CHEBI:34720) has role sedative (CHEBI:35717) |
| diphenhydramine salicylate (CHEBI:34720) is a organoammonium salt (CHEBI:46850) |
| diphenhydramine salicylate (CHEBI:34720) is a salicylates (CHEBI:26596) |
| IUPAC Name |
|---|
| 2-(diphenylmethoxy)-N,N-dimethylethanaminium 2-hydroxybenzoate |
| Synonym | Source |
|---|---|
| Diphenhydramine salicylate | KEGG COMPOUND |