EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34696 - dieldrin
| Formula | C12H8Cl6O |
| Net Charge | 0 |
| Average Mass | 380.913 |
| Monoisotopic Mass | 377.87063 |
| SMILES | [H][C@]12[C@H]3C[C@H]([C@@H]4O[C@@H]43)[C@@]1([H])[C@@]1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C12H8Cl6O/c13-8-9(14)11(16)5-3-1-2(6-7(3)19-6)4(5)10(8,15)12(11,17)18/h2-7H,1H2/t2-,3+,4+,5-,6-,7+,10+,11- |
| InChIKey | DFBKLUNHFCTMDC-PICURKEMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dieldrin (CHEBI:34696) has functional parent aldrin (CHEBI:2564) |
| dieldrin (CHEBI:34696) has role carcinogenic agent (CHEBI:50903) |
| dieldrin (CHEBI:34696) has role xenobiotic (CHEBI:35703) |
| dieldrin (CHEBI:34696) is a epoxide (CHEBI:32955) |
| dieldrin (CHEBI:34696) is a organochlorine compound (CHEBI:36683) |
| dieldrin (CHEBI:34696) is a organochlorine insecticide (CHEBI:25705) |
| IUPAC Name |
|---|
| rel-(1R,2S,3S,6R,7R,8S,9S,11R)-3,4,5,6,13,13-hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-ene |
| Synonyms | Source |
|---|---|
| Dieldrin | KEGG COMPOUND |
| (1R,4S,4aS,5R,6R,7S,8S,8aR)-1,2,3,4,10,10-Hexachloro-1,4,4a,5,6,7,8,8a-octahydro-6,7-epoxy-1,4:5,8-dimethanonaphthalene | ChemIDplus |
| 1,2,3,4,10,10-Hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4-endo-exo-5,8-dimethanonaphthalene | NIST Chemistry WebBook |
| 2,7:3,6-Dimethanonaphth[2,3-b]oxirene, 3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-, (1aα,2β,2aα,3β,6β,6aα,7β,7aα)- | NIST Chemistry WebBook |
| (1aα,2β,2aα,3β,6β,6aα,7β,7aα)-3,4,5,6,9,9-hexachloro-1a,2,2a,3,6,6a,7,7a-octahydro-2,7:3,6-dimethanonaphtho[2,3-b]oxirene | ChEBI |
| HEOD | ChEBI |
| Citations |
|---|