EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8Cl6 |
| Net Charge | 0 |
| Average Mass | 364.914 |
| Monoisotopic Mass | 361.87572 |
| SMILES | [H][C@]12[C@@H]3C=C[C@@H](C3)[C@@]1([H])[C@@]1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C12H8Cl6/c13-8-9(14)11(16)7-5-2-1-4(3-5)6(7)10(8,15)12(11,17)18/h1-2,4-7H,3H2/t4-,5+,6+,7-,10+,11- |
| InChIKey | QBYJBZPUGVGKQQ-SJJAEHHWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Applications: | proinsecticide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proinsecticide. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldrin (CHEBI:2564) has role persistent organic pollutant (CHEBI:77853) |
| aldrin (CHEBI:2564) has role proinsecticide (CHEBI:136644) |
| aldrin (CHEBI:2564) is a organochlorine compound (CHEBI:36683) |
| aldrin (CHEBI:2564) is a organochlorine insecticide (CHEBI:25705) |
| Incoming Relation(s) |
| dieldrin (CHEBI:34696) has functional parent aldrin (CHEBI:2564) |
| IUPAC Name |
|---|
| (1R,4S,4aS,5S,8R,8aR)-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene |
| Synonyms | Source |
|---|---|
| 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-endo-1,4-exo-5,8-dimethanonaphthalene | NIST Chemistry WebBook |
| 1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-exo-1,4-endo-5,8-dimethanonaphthalene | NIST Chemistry WebBook |
| (1α,4α,4aβ,5α,8α,8aβ)-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene | ChemIDplus |
| aldrine | ChemIDplus |
| Compound 118 | ChemIDplus |
| HHDN | ChemIDplus |
| Citations |
|---|