EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9Cl5O |
| Net Charge | 0 |
| Average Mass | 370.490 |
| Monoisotopic Mass | 367.90960 |
| SMILES | OC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H |
| InChIKey | UOAMTSKGCBMZTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicofol (CHEBI:34692) has functional parent DDT (CHEBI:16130) |
| dicofol (CHEBI:34692) is a monochlorobenzenes (CHEBI:83403) |
| dicofol (CHEBI:34692) is a organochlorine acaricide (CHEBI:38657) |
| dicofol (CHEBI:34692) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol |
| Synonyms | Source |
|---|---|
| Dicofol | KEGG COMPOUND |
| Kelthane | KEGG COMPOUND |
| 4,4'-dichloro-α-(trichloromethyl)benzhydrol | NIST Chemistry WebBook |
| 1,1-bis(4-chlorophenyl)-2,2,2-trichloroethanol | ChemIDplus |
| 4-chloro-α-(4-chlorophenyl)-α-(trichloromethyl)benzenemethanol | NIST Chemistry WebBook |
| 2,2,2-trichloro-1,1-bis(p-chlorophenyl)ethanol | ChemIDplus |