EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16130 - DDT
| Formula | C14H9Cl5 |
| Net Charge | 0 |
| Average Mass | 354.491 |
| Monoisotopic Mass | 351.91469 |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H9Cl5/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10/h1-8,13H |
| InChIKey | YVGGHNCTFXOJCH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DDT (CHEBI:16130) has functional parent 1,1,1-trichloro-2,2-diphenylethane (CHEBI:39161) |
| DDT (CHEBI:16130) has functional parent 4,4'-dichlorodiphenylmethane (CHEBI:28763) |
| DDT (CHEBI:16130) has role bridged diphenyl acaricide (CHEBI:39412) |
| DDT (CHEBI:16130) has role carcinogenic agent (CHEBI:50903) |
| DDT (CHEBI:16130) has role endocrine disruptor (CHEBI:138015) |
| DDT (CHEBI:16130) has role persistent organic pollutant (CHEBI:77853) |
| DDT (CHEBI:16130) is a benzenoid aromatic compound (CHEBI:33836) |
| DDT (CHEBI:16130) is a chlorophenylethane (CHEBI:23154) |
| DDT (CHEBI:16130) is a monochlorobenzenes (CHEBI:83403) |
| DDT (CHEBI:16130) is a organochlorine insecticide (CHEBI:25705) |
| Incoming Relation(s) |
| 2,3-dihydroxy-DDT (CHEBI:46745) has functional parent DDT (CHEBI:16130) |
| dicofol (CHEBI:34692) has functional parent DDT (CHEBI:16130) |
| IUPAC Name |
|---|
| 1-chloro-4-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]benzene |
| Synonyms | Source |
|---|---|
| 1,1,1-Trichloro-2,2-bis(4-chlorophenyl)ethane | KEGG COMPOUND |
| 1,1,1-Trichloro-2,2-bis(4-chlorophenyl)ethane | KEGG COMPOUND |
| 1,1,1-Trichloro-2,2-bis-(4'-chlorophenyl)ethane | KEGG COMPOUND |
| 1,1'-(2,2,2-trichloroethylidene)bis[4-chlorobenzene] | UM-BBD |
| 1,1-bis(4-chlorophenyl)-2,2,2-trichloroethane | NIST Chemistry WebBook |
| 4,4'-DDT | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane | UniProt |
| Citations |
|---|