EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16 |
| Net Charge | 0 |
| Average Mass | 268.359 |
| Monoisotopic Mass | 268.12520 |
| SMILES | Cc1ccc2cc3c(ccc4ccccc43)c3c2c1CC3 |
| InChI | InChI=1S/C21H16/c1-13-6-7-15-12-20-17-5-3-2-4-14(17)8-9-18(20)19-11-10-16(13)21(15)19/h2-9,12H,10-11H2,1H3 |
| InChIKey | PPQNQXQZIWHJRB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylcholanthrene (CHEBI:34342) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| 3-methylcholanthrene (CHEBI:34342) has role carcinogenic agent (CHEBI:50903) |
| 3-methylcholanthrene (CHEBI:34342) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| Incoming Relation(s) |
| 11,12-epoxy-3-methylcholanthrene (CHEBI:142244) has functional parent 3-methylcholanthrene (CHEBI:34342) |
| IUPAC Name |
|---|
| 3-methyl-1,2-dihydrocyclopenta[ij]tetraphene |
| Synonyms | Source |
|---|---|
| 1,2-Dihydro-3-methylbenz(j)aceanthrylene | ChemIDplus |
| 20-MC | ChemIDplus |
| 20-Methylcholanthrene | NIST Chemistry WebBook |
| 20-Methylcholanthrene | ChemIDplus |
| 3-MC | ChemIDplus |
| 3-MCA | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14470 | KEGG COMPOUND |
| LSM-5711 | LINCS |
| Methylcholanthrene | Wikipedia |
| Citations |
|---|