EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16O |
| Net Charge | 0 |
| Average Mass | 284.358 |
| Monoisotopic Mass | 284.12012 |
| SMILES | Cc1ccc2cc3c(c4c2c1CC4)C1OC1c1ccccc1-3 |
| InChI | InChI=1S/C21H16O/c1-11-6-7-12-10-17-14-4-2-3-5-15(14)20-21(22-20)19(17)16-9-8-13(11)18(12)16/h2-7,10,20-21H,8-9H2,1H3 |
| InChIKey | LFYCWMXAEDCADG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11,12-epoxy-3-methylcholanthrene (CHEBI:142244) has functional parent 3-methylcholanthrene (CHEBI:34342) |
| 11,12-epoxy-3-methylcholanthrene (CHEBI:142244) has role mutagen (CHEBI:25435) |
| 11,12-epoxy-3-methylcholanthrene (CHEBI:142244) is a epoxide (CHEBI:32955) |
| 11,12-epoxy-3-methylcholanthrene (CHEBI:142244) is a organic heterohexacyclic compound (CHEBI:51914) |
| IUPAC Name |
|---|
| 9-methyl-1a,10,11,11c-tetrahydrocyclopenta[7,8]tetrapheno[5,6-b]oxirene |
| Synonyms | Source |
|---|---|
| 9-methyl-1a,10,11,11c-tetrahydrobenzo[7,8]aceanthryleno[10,9-b]oxirene | IUPAC |
| 3-methylcholanthrene-11,12-epoxide | ChemIDplus |
| 11,12-epoxy-11,12-dihydro-3-methylcholanthrene | ChEBI |
| 11,12-dihydro-11,12-epoxy-3-methylcholanthrene | ChemIDplus |
| 1a,10,11,11c-tetrahydro-9-methylbenz[7,8]aceanthryleno[9,10-b]oxirene | NIST Chemistry WebBook |
| 11,12-epoxy-3-methyl-1,2,11,12-tetrahydro-benzo[j]aceanthrylene | ChEBI |
| Citations |
|---|