EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O3 |
| Net Charge | 0 |
| Average Mass | 226.236 |
| Monoisotopic Mass | 226.10659 |
| SMILES | NCCC(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 |
| InChIKey | CQOVPNPJLQNMDC-ZETCQYMHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticonvulsant A drug used to prevent seizures or reduce their severity. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carnosine (CHEBI:15727) has role Daphnia magna metabolite (CHEBI:83056) |
| carnosine (CHEBI:15727) has role anticonvulsant (CHEBI:35623) |
| carnosine (CHEBI:15727) has role antineoplastic agent (CHEBI:35610) |
| carnosine (CHEBI:15727) has role antioxidant (CHEBI:22586) |
| carnosine (CHEBI:15727) has role geroprotector (CHEBI:176497) |
| carnosine (CHEBI:15727) has role human metabolite (CHEBI:77746) |
| carnosine (CHEBI:15727) has role mouse metabolite (CHEBI:75771) |
| carnosine (CHEBI:15727) has role neuroprotective agent (CHEBI:63726) |
| carnosine (CHEBI:15727) is a dipeptide (CHEBI:46761) |
| carnosine (CHEBI:15727) is conjugate acid of carnosinate (CHEBI:66874) |
| carnosine (CHEBI:15727) is tautomer of carnosine zwitterion (CHEBI:57485) |
| Incoming Relation(s) |
| N-acetylcarnosine (CHEBI:67249) has functional parent carnosine (CHEBI:15727) |
| carnosinate (CHEBI:66874) is conjugate base of carnosine (CHEBI:15727) |
| carnosine zwitterion (CHEBI:57485) is tautomer of carnosine (CHEBI:15727) |
| IUPAC Name |
|---|
| Nα-(β-alanyl)-L-histidine |
| Synonyms | Source |
|---|---|
| (2S)-2-(3-aminopropanamido)-3-(1H-imidazol-4-yl)propanoic acid | IUPAC |
| beta-alanyl-L-histidine | ChEBI |
| Carnosine | KEGG COMPOUND |
| N-(3-aminopropanoyl)-L-histidine | ChEBI |
| N-β-alanyl-L-histidine | HMDB |
| ignotine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Karnozin | ChemIDplus |
| Karnozzn | ChemIDplus |
| Citations |
|---|