EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O |
| Net Charge | 0 |
| Average Mass | 122.167 |
| Monoisotopic Mass | 122.07316 |
| SMILES | Cc1ccc(O)c(C)c1 |
| InChI | InChI=1S/C8H10O/c1-6-3-4-8(9)7(2)5-6/h3-5,9H,1-2H3 |
| InChIKey | KUFFULVDNCHOFZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus sibirica (ncbitaxon:62752) | - | PubMed (25641836) |
| Roles Classification |
|---|
| Biological Roles: | disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-xylenol (CHEBI:34241) has parent hydride m-xylene (CHEBI:28488) |
| 2,4-xylenol (CHEBI:34241) has role disinfectant (CHEBI:48219) |
| 2,4-xylenol (CHEBI:34241) has role volatile oil component (CHEBI:27311) |
| 2,4-xylenol (CHEBI:34241) is a aromatic fungicide (CHEBI:87034) |
| 2,4-xylenol (CHEBI:34241) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 2,4-dimethylphenyl hydrogen sulfate (CHEBI:191380) has functional parent 2,4-xylenol (CHEBI:34241) |
| IUPAC Name |
|---|
| 2,4-dimethylphenol |
| Synonyms | Source |
|---|---|
| 1,3-dimethyl-4-hydroxybenzene | NIST Chemistry WebBook |
| 1-hydroxy-2,4-dimethylbenzene | ChemIDplus |
| 2,4-DMP | PPDB |
| 2-methyl-p-cresol | ChEBI |
| 4,6-dimethylphenol | ChemIDplus |
| 4-hydroxy-1,3-dimethylbenzene | ChemIDplus |
| Citations |
|---|