EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3423 - carmustine
| Formula | C5H9Cl2N3O2 |
| Net Charge | 0 |
| Average Mass | 214.052 |
| Monoisotopic Mass | 213.00718 |
| SMILES | O=NN(CCCl)C(=O)NCCCl |
| InChI | InChI=1S/C5H9Cl2N3O2/c6-1-3-8-5(11)10(9-12)4-2-7/h1-4H2,(H,8,11) |
| InChIKey | DLGOEMSEDOSKAD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carmustine (CHEBI:3423) has role alkylating agent (CHEBI:22333) |
| carmustine (CHEBI:3423) has role anti-inflammatory agent (CHEBI:67079) |
| carmustine (CHEBI:3423) has role antineoplastic agent (CHEBI:35610) |
| carmustine (CHEBI:3423) has role immunosuppressive agent (CHEBI:35705) |
| carmustine (CHEBI:3423) is a N-nitrosoureas (CHEBI:76551) |
| carmustine (CHEBI:3423) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 1,3-bis(2-chloroethyl)-1-nitrosourea |
| INNs | Source |
|---|---|
| carmustina | WHO MedNet |
| carmustine | WHO MedNet |
| carmustine | WHO MedNet |
| carmustinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BCNU | KEGG COMPOUND |
| Bicnu (TN) | KEGG DRUG |
| Bischloroethyl nitrosourea | KEGG COMPOUND |
| Camustine | ChEMBL |
| Carmustine | KEGG DRUG |
| DTI-015 | ChEMBL |
| Brand Names | Source |
|---|---|
| Bicnu | ChEMBL |
| Carmustine medac (previously carmustine obvius) | ChEMBL |
| Carmustine obvius | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 512 | DrugCentral |
| Carmustine | Wikipedia |
| D00254 | KEGG DRUG |
| DB00262 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:154-93-8 | KEGG DRUG |
| CAS:154-93-8 | ChemIDplus |
| Citations |
|---|