EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)[C@H](O)C[C@@]21[H] |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)22/h9,13-17,21-22H,3-8,10H2,1-2H3/t13-,14+,15+,16-,17+,18+,19+/m1/s1 |
| InChIKey | YMCWOAZGWMZGQT-FPNLOETNSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16α-hydroxytestosterone (CHEBI:34172) has functional parent testosterone (CHEBI:17347) |
| 16α-hydroxytestosterone (CHEBI:34172) has role androgen (CHEBI:50113) |
| 16α-hydroxytestosterone (CHEBI:34172) is a 16α-hydroxy steroid (CHEBI:16799) |
| 16α-hydroxytestosterone (CHEBI:34172) is a 17β-hydroxy steroid (CHEBI:35343) |
| 16α-hydroxytestosterone (CHEBI:34172) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 16α-hydroxytestosterone (CHEBI:34172) is a androstanoid (CHEBI:50402) |
| 16α-hydroxytestosterone (CHEBI:34172) is a C19-steroid (CHEBI:131621) |
| 16α-hydroxytestosterone (CHEBI:34172) is a diol (CHEBI:23824) |
| 16α-hydroxytestosterone (CHEBI:34172) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 16α,17β-dihydroxyandrost-4-en-3-one |
| Synonym | Source |
|---|---|
| (16α,17β)-16,17-dihydroxyandrost-4-en-3-one | IUPAC |
| UniProt Name | Source |
|---|---|
| 16α,17β-dihydroxyandrost-4-en-3-one | UniProt |
| Citations |
|---|