EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | CCCCCC1OC1C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-12-15-18-19(23-18)16-13-10-8-6-4-5-7-9-11-14-17-20(21)22/h4,6-7,9-10,13,18-19H,2-3,5,8,11-12,14-17H2,1H3,(H,21,22)/b6-4-,9-7-,13-10- |
| InChIKey | JBSCUHKPLGKXKH-ILYOTBPNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14,15-EET (CHEBI:34157) has role mouse metabolite (CHEBI:75771) |
| 14,15-EET (CHEBI:34157) is a EET (CHEBI:64007) |
| 14,15-EET (CHEBI:34157) is conjugate acid of 14,15-EET(1−) (CHEBI:84024) |
| Incoming Relation(s) |
| N-[(5Z,8Z,11Z)-14,15-epoxyicosatrienoyl]ethanolamine (CHEBI:136991) has functional parent 14,15-EET (CHEBI:34157) |
| 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoyl-CoA (CHEBI:137050) has functional parent 14,15-EET (CHEBI:34157) |
| 2-glyceryl 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate (CHEBI:132121) has functional parent 14,15-EET (CHEBI:34157) |
| (14R,15S)-EET (CHEBI:132275) is a 14,15-EET (CHEBI:34157) |
| (14S,15R)-EET (CHEBI:132274) is a 14,15-EET (CHEBI:34157) |
| 14,15-EET(1−) (CHEBI:84024) is conjugate base of 14,15-EET (CHEBI:34157) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoic acid |
| Synonyms | Source |
|---|---|
| (+/-)14,15-EpETrE | LIPID MAPS |
| 14,15-EpETrE | HMDB |
| 14(15)-EpETrE | HMDB |
| 14,15-epoxy-5Z,8Z,11Z-icosatrienoic acid | ChEBI |
| 14,15-epoxy-5Z,8Z,11Z-eicosatrienoic acid | LIPID MAPS |
| (5Z,8Z,11Z)-14,15-Epoxyeicosa-5.8.11-trienoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14771 | KEGG COMPOUND |
| HMDB0004264 | HMDB |
| LMFA03080005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4703440 | Reaxys |
| Citations |
|---|