EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O5 |
| Net Charge | 0 |
| Average Mass | 394.552 |
| Monoisotopic Mass | 394.27192 |
| SMILES | CCCCCC1OC1C/C=C\C/C=C\C/C=C\CCCC(=O)OC(CO)CO |
| InChI | InChI=1S/C23H38O5/c1-2-3-12-15-21-22(28-21)16-13-10-8-6-4-5-7-9-11-14-17-23(26)27-20(18-24)19-25/h4,6-7,9-10,13,20-22,24-25H,2-3,5,8,11-12,14-19H2,1H3/b6-4-,9-7-,13-10- |
| InChIKey | LPMVKZXODWQHGJ-ILYOTBPNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (18606824) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. mitogen A chemical substance that encourages a cell to commence cell division, triggering mitosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-glyceryl 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate (CHEBI:132121) has functional parent 14,15-EET (CHEBI:34157) |
| 2-glyceryl 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate (CHEBI:132121) has role human urinary metabolite (CHEBI:84087) |
| 2-glyceryl 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate (CHEBI:132121) has role human xenobiotic metabolite (CHEBI:76967) |
| 2-glyceryl 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate (CHEBI:132121) has role mitogen (CHEBI:52290) |
| 2-glyceryl 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate (CHEBI:132121) has role PPARα agonist (CHEBI:70782) |
| 2-glyceryl 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate (CHEBI:132121) is a 2-monoglyceride (CHEBI:17389) |
| 2-glyceryl 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate (CHEBI:132121) is a epoxide (CHEBI:32955) |
| 2-glyceryl 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoate (CHEBI:132121) is a polyunsaturated fatty ester (CHEBI:145039) |
| IUPAC Name |
|---|
| 1,3-dihydroxypropan-2-yl (5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoate |
| Synonyms | Source |
|---|---|
| 14,15-EET 2-glyceryl ester | ChEBI |
| 14,15-epoxy-(5Z,8Z,11Z)-eicosatrienoic acid 2-glyceryl ester | ChEBI |
| 14,15-epoxy-(5Z,8Z,11Z)-icosatrienoic acid 2-glyceryl ester | ChEBI |
| 2-14,15-EG | ChEBI |
| 2-[14,15-epoxy-(5Z,8Z,11Z)-eicosatrienoyl]glycerol | ChEBI |
| 2-[14,15-epoxy-(5Z,8Z,11Z)-icosatrienoyl]glycerol | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-glyceryl-14,15-epoxy-(5Z,8Z,11Z)-eicosatrienoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013651 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24312050 | Reaxys |
| CAS:848667-56-1 | HMDB |
| Citations |
|---|