EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])C(=O)C[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H26O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-14,16-17,22H,3-8,10H2,1-2H3/t13-,14-,16-,17+,18-,19-/m0/s1 |
| InChIKey | WTPMRQZHJLJSBO-XQALERBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acipenser ruthenus (ncbitaxon:7906) | - | PubMed (28109018) | |
| Amatitlania siquia (ncbitaxon:1537670) | - | PubMed (27793721) | |
| Anguilla australis (ncbitaxon:7940) | - | PubMed (26764051) | |
| Astyanax altiparanae (ncbitaxon:142828) | - | PubMed (27025723) | |
| Clarias batrachus (ncbitaxon:59899) | - | PubMed (28666831) | |
| Danio rerio (ncbitaxon:7955) | - | PubMed (27927697) | |
| Epinephelus marginatus (ncbitaxon:179535) | - | PubMed (28652135) | |
| Helicolenus dactylopterus (ncbitaxon:202727) | - | PubMed (28321875) | |
| Hippocampus erectus (ncbitaxon:109281) | - | PubMed (28197868) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (27428878) | |
| Kryptolebias marmoratus (ncbitaxon:37003) | - | PubMed (27750118) | |
| Lamprologus callipterus (ncbitaxon:32501) | - | PubMed (27852761) | |
| Oreochromis niloticus (ncbitaxon:8128) | - | PubMed (27044511) | |
| Oryzias latipes (ncbitaxon:8090) | - | PubMed (28279673) | |
| Pollachius virens (ncbitaxon:8060) | - | PubMed (27734466) | |
| Sparus aurata (ncbitaxon:8175) | - | PubMed (28095297) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-oxotestosterone (CHEBI:34133) has functional parent testosterone (CHEBI:17347) |
| 11-oxotestosterone (CHEBI:34133) has parent hydride androstane (CHEBI:35509) |
| 11-oxotestosterone (CHEBI:34133) has role androgen (CHEBI:50113) |
| 11-oxotestosterone (CHEBI:34133) has role human metabolite (CHEBI:77746) |
| 11-oxotestosterone (CHEBI:34133) has role marine xenobiotic metabolite (CHEBI:83399) |
| 11-oxotestosterone (CHEBI:34133) is a 11-oxo steroid (CHEBI:47787) |
| 11-oxotestosterone (CHEBI:34133) is a 17β-hydroxy steroid (CHEBI:35343) |
| 11-oxotestosterone (CHEBI:34133) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 11-oxotestosterone (CHEBI:34133) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 17β-hydroxyandrost-4-ene-3,11-dione |
| Synonyms | Source |
|---|---|
| 11-Keto-testosterone | KEGG COMPOUND |
| 11-Ketotestosterone | ChemIDplus |
| 17beta-Hydroxyandrost-4-ene-3,11-dione | KEGG COMPOUND |
| (17β)-17-hydroxyandrost-4-ene-3,11-dione | IUPAC |
| UniProt Name | Source |
|---|---|
| 17β-hydroxyandrost-4-ene-3,11-dione | UniProt |
| Citations |
|---|