EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2112A-1a_1-5]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2+,3+,4-,6-/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-BKBMJHBISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-galacturonic acid (CHEBI:33885) is a D-galactopyranuronic acid (CHEBI:4153) |
| α-D-galacturonic acid (CHEBI:33885) is conjugate acid of α-D-galacturonate (CHEBI:58658) |
| Incoming Relation(s) |
| 1-phospho-α-D-galacturonic acid (CHEBI:17543) has functional parent α-D-galacturonic acid (CHEBI:33885) |
| UDP-D-galacturonic acid (CHEBI:13488) has functional parent α-D-galacturonic acid (CHEBI:33885) |
| UDP-α-D-galacturonic acid (CHEBI:16085) has functional parent α-D-galacturonic acid (CHEBI:33885) |
| α-D-galacturonate (CHEBI:58658) is conjugate base of α-D-galacturonic acid (CHEBI:33885) |
| IUPAC Name |
|---|
| α-D-galactopyranuronic acid |
| Manual Xrefs | Databases |
|---|---|
| ADA | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1221534 | Gmelin |
| Reaxys:1285547 | Reaxys |