EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O6 |
| Net Charge | 0 |
| Average Mass | 166.129 |
| Monoisotopic Mass | 166.04774 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A211h]/1/ |
| InChI | InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3-,4+/m0/s1 |
| InChIKey | QXKAIJAYHKCRRA-YVZJFKFKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-arabinonic acid (CHEBI:33510) is a arabinonic acid (CHEBI:33509) |
| L-arabinonic acid (CHEBI:33510) is conjugate acid of L-arabinonate (CHEBI:16501) |
| L-arabinonic acid (CHEBI:33510) is enantiomer of D-arabinonic acid (CHEBI:20912) |
| Incoming Relation(s) |
| L-arabinono-1,4-lactone (CHEBI:17100) has functional parent L-arabinonic acid (CHEBI:33510) |
| 2-dehydro-3-deoxy-L-arabinonic acid (CHEBI:17647) has functional parent L-arabinonic acid (CHEBI:33510) |
| 5-phospho-L-arabinonic acid (CHEBI:136754) has functional parent L-arabinonic acid (CHEBI:33510) |
| L-arabinonate (CHEBI:16501) is conjugate base of L-arabinonic acid (CHEBI:33510) |
| D-arabinonic acid (CHEBI:20912) is enantiomer of L-arabinonic acid (CHEBI:33510) |
| Manual Xrefs | Databases |
|---|---|
| C00545 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1724269 | Beilstein |
| CAS:608-53-7 | KEGG COMPOUND |