EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O5 |
| Net Charge | 0 |
| Average Mass | 148.114 |
| Monoisotopic Mass | 148.03717 |
| SMILES | O=C(O)C(=O)C[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[AOd1h]/1/ |
| InChI | InChI=1S/C5H8O5/c6-2-3(7)1-4(8)5(9)10/h3,6-7H,1-2H2,(H,9,10)/t3-/m1/s1 |
| InChIKey | UQIGQRSJIKIPKZ-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-dehydro-3-deoxy-L-arabinonic acid (CHEBI:17647) has functional parent L-arabinonic acid (CHEBI:33510) |
| 2-dehydro-3-deoxy-L-arabinonic acid (CHEBI:17647) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-dehydro-3-deoxy-L-arabinonic acid (CHEBI:17647) is a ketoaldonic acid (CHEBI:24963) |
| 2-dehydro-3-deoxy-L-arabinonic acid (CHEBI:17647) is a pentonic acid (CHEBI:33753) |
| 2-dehydro-3-deoxy-L-arabinonic acid (CHEBI:17647) is conjugate acid of 2-dehydro-3-deoxy-L-arabinonate (CHEBI:35173) |
| 2-dehydro-3-deoxy-L-arabinonic acid (CHEBI:17647) is enantiomer of 2-dehydro-3-deoxy-D-arabinonic acid (CHEBI:1060) |
| Incoming Relation(s) |
| 2-dehydro-3-deoxy-L-arabinonate (CHEBI:35173) is conjugate base of 2-dehydro-3-deoxy-L-arabinonic acid (CHEBI:17647) |
| 2-dehydro-3-deoxy-D-arabinonic acid (CHEBI:1060) is enantiomer of 2-dehydro-3-deoxy-L-arabinonic acid (CHEBI:17647) |
| IUPAC Name |
|---|
| 3-deoxy-L-pent-2-ulosonic acid |
| Synonyms | Source |
|---|---|
| 2-dehydro-3-deoxy-L-arabinonic acid | ChEBI |
| 2-dehydro-3-deoxy-L-pentonic acid | ChEBI |