EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HO6S3 |
| Net Charge | -1 |
| Average Mass | 193.203 |
| Monoisotopic Mass | 192.89407 |
| SMILES | [H]OS(=O)(=O)SS(=O)(=O)[O-] |
| InChI | InChI=1S/H2O6S3/c1-8(2,3)7-9(4,5)6/h(H,1,2,3)(H,4,5,6)/p-1 |
| InChIKey | KRURGYOKPVLRHQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trithionate(1−) (CHEBI:33483) is a sulfur oxoanion (CHEBI:33482) |
| trithionate(1−) (CHEBI:33483) is conjugate acid of trithionate(2−) (CHEBI:15987) |
| trithionate(1−) (CHEBI:33483) is conjugate base of trithionic acid (CHEBI:29210) |
| Incoming Relation(s) |
| trithionic acid (CHEBI:29210) is conjugate acid of trithionate(1−) (CHEBI:33483) |
| trithionate(2−) (CHEBI:15987) is conjugate base of trithionate(1−) (CHEBI:33483) |
| IUPAC Name |
|---|
| hydrogen trithionate |
| Synonyms | Source |
|---|---|
| [HS3O6]− | ChEBI |
| [O3SSS(O)2(OH)]− | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1746128 | Gmelin |