EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O6S3 |
| Net Charge | 0 |
| Average Mass | 194.211 |
| Monoisotopic Mass | 193.90135 |
| SMILES | [H]OS(=O)(=O)SS(=O)(=O)O[H] |
| InChI | InChI=1S/H2O6S3/c1-8(2,3)7-9(4,5)6/h(H,1,2,3)(H,4,5,6) |
| InChIKey | KRURGYOKPVLRHQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trithionic acid (CHEBI:29210) is a sulfur oxoacid (CHEBI:33402) |
| trithionic acid (CHEBI:29210) is conjugate acid of trithionate(1−) (CHEBI:33483) |
| Incoming Relation(s) |
| trithionate(1−) (CHEBI:33483) is conjugate base of trithionic acid (CHEBI:29210) |
| IUPAC Names |
|---|
| 1,5-dihydrido-2,2,4,4-tetraoxido-1,5-dioxy-2,3,4-trisulfy-[5]catena |
| trithionic acid |
| Synonyms | Source |
|---|---|
| [(HO)(O)2SSS(O)2(OH)] | IUPAC |
| H2S3O6 | IUPAC |
| Trithionsäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:217937 | Gmelin |
| CAS:27621-39-2 | ChemIDplus |