EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H74IN3O21S4 |
| Net Charge | 0 |
| Average Mass | 1368.369 |
| Monoisotopic Mass | 1367.27424 |
| SMILES | [H][C@]1(O[C@@H]2O[C@@H](C)[C@@H](NO[C@H]3C[C@H](O)[C@H](SC(=O)c4c(C)c(I)c(O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](OC)[C@H]5O)c(OC)c4OC)[C@@H](C)O3)[C@H](O)[C@H]2O[C@H]2C[C@H](OC)[C@@H](NCC)CO2)C#C/C=C\C#C[C@]2(O)CC(=O)C(NC(=O)OC)=C1/C2=C\CSSSC |
| InChI | InChI=1S/C55H74IN3O21S4/c1-12-57-30-24-73-35(22-34(30)68-6)78-48-43(63)40(26(3)75-53(48)77-33-17-15-13-14-16-19-55(67)23-32(61)41(58-54(66)72-10)38(33)29(55)18-20-82-84-81-11)59-80-36-21-31(60)50(28(5)74-36)83-51(65)37-25(2)39(56)46(49(71-9)45(37)69-7)79-52-44(64)47(70-8)42(62)27(4)76-52/h13-14,18,26-28,30-31,33-36,40,42-44,47-48,50,52-53,57,59-60,62-64,67H,12,20-24H2,1-11H3,(H,58,66)/b14-13-,29-18+/t26-,27-,28+,30-,31-,33-,34-,35-,36-,40+,42-,43-,44+,47+,48+,50+,52-,53-,55-/m0/s1 |
| InChIKey | HXCHCVDVKSCDHU-LHTKNVSWSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calicheamicin γ1I (CHEBI:3319) has role antineoplastic agent (CHEBI:35610) |
| calicheamicin γ1I (CHEBI:3319) has role metabolite (CHEBI:25212) |
| calicheamicin γ1I (CHEBI:3319) is a calicheamicin (CHEBI:64068) |
| calicheamicin γ1I (CHEBI:3319) is a enediyne antibiotic (CHEBI:53268) |
| calicheamicin γ1I (CHEBI:3319) is a organoiodine compound (CHEBI:37142) |
| Synonyms | Source |
|---|---|
| Calicheamicin gamma(1)I | KEGG COMPOUND |
| Calichemicin gamma1 | KEGG COMPOUND |
| calicheamicin γ1 | ChEBI |
| calicheamicin gamma(1,I) | ChemIDplus |
| calicheamicin gamma(1)I | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11469 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9894883 | Reaxys |
| CAS:108212-75-5 | KEGG COMPOUND |
| CAS:108212-75-5 | ChemIDplus |
| Citations |
|---|