EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7N |
| Net Charge | 0 |
| Average Mass | 117.151 |
| Monoisotopic Mass | 117.05785 |
| SMILES | c1ccc2cncc2c1 |
| InChI | InChI=1S/C8H7N/c1-2-4-8-6-9-5-7(8)3-1/h1-6,9H |
| InChIKey | VHMICKWLTGFITH-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2H-isoindole (CHEBI:33179) is a isoindole (CHEBI:35582) |
| 2H-isoindole (CHEBI:33179) is a polycyclic heteroarene (CHEBI:38180) |
| 2H-isoindole (CHEBI:33179) is tautomer of 1H-isoindole (CHEBI:33178) |
| Incoming Relation(s) |
| 1H-isoindole (CHEBI:33178) is tautomer of 2H-isoindole (CHEBI:33179) |
| Synonym | Source |
|---|---|
| 2H-isoindole | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1280861 | Beilstein |
| Gmelin:720191 | Gmelin |
| CAS:270-68-8 | ChemIDplus |