EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7N |
| Net Charge | 0 |
| Average Mass | 117.151 |
| Monoisotopic Mass | 117.05785 |
| SMILES | C1=NCc2ccccc21 |
| InChI | InChI=1S/C8H7N/c1-2-4-8-6-9-5-7(8)3-1/h1-5H,6H2 |
| InChIKey | LFHLEABTNIQIQO-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-isoindole (CHEBI:33178) is a isoindole (CHEBI:35582) |
| 1H-isoindole (CHEBI:33178) is tautomer of 2H-isoindole (CHEBI:33179) |
| Incoming Relation(s) |
| 2H-isoindole (CHEBI:33179) is tautomer of 1H-isoindole (CHEBI:33178) |
| IUPAC Name |
|---|
| 1H-isoindole |
| Registry Numbers | Sources |
|---|---|
| Gmelin:774198 | Gmelin |
| Beilstein:636123 | Beilstein |