EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60 |
| Net Charge | 0 |
| Average Mass | 720.660 |
| Monoisotopic Mass | 720.00000 |
| SMILES | c12c3c4c5c1c1c6c7c2c2c8c3c3c9c4c4c%10c5c5c1c1c6c6c%11c7c2c2c7c8c3c3c8c9c4c4c9c%10c5c5c1c1c6c6c%11c2c2c7c3c3c8c4c4c9c5c1c1c6c2c3c41 |
| InChI | InChI=1S/C60/c1-2-5-6-3(1)8-12-10-4(1)9-11-7(2)17-21-13(5)23-24-14(6)22-18(8)28-20(12)30-26-16(10)15(9)25-29-19(11)27(17)37-41-31(21)33(23)43-44-34(24)32(22)42-38(28)48-40(30)46-36(26)35(25)45-39(29)47(37)55-49(41)51(43)57-52(44)50(42)56(48)59-54(46)53(45)58(55)60(57)59 |
| InChIKey | XMWRBQBLMFGWIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C60 fullerene (CHEBI:33128) has role geroprotector (CHEBI:176497) |
| C60 fullerene (CHEBI:33128) is a fullerene (CHEBI:33416) |
| IUPAC Name |
|---|
| (C60-Ih)[5,6]fullerene |
| Synonyms | Source |
|---|---|
| buckminsterfullerene | NIST Chemistry WebBook |
| footballene | ChemIDplus |
| fullerene C60 | ChemIDplus |
| [60-Ih]fullerene | IUPAC |
| [5,6]fullerene-C60-Ih | ChemIDplus |
| Buckyball | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 110185 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Gmelin:100331 | Gmelin |
| Reaxys:5901022 | Reaxys |
| CAS:99685-96-8 | ChemIDplus |
| CAS:99685-96-8 | NIST Chemistry WebBook |
| Citations |
|---|