EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CO3.Ca |
| Net Charge | 0 |
| Average Mass | 100.086 |
| Monoisotopic Mass | 99.94733 |
| SMILES | O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/CH2O3.Ca/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| InChIKey | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food firming agent A food additive that is used to make or keep fruit or vegetable tissues firm and crisp. or which interacts with gelling agents such as pectin to produce or strengthen a gel. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Biological Roles: | antacid Any substance which is used to neutralise stomach acidity. food firming agent A food additive that is used to make or keep fruit or vegetable tissues firm and crisp. or which interacts with gelling agents such as pectin to produce or strengthen a gel. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). nutrient A nutrient is a food component that an organism uses to survive and grow. |
| Applications: | antacid Any substance which is used to neutralise stomach acidity. food firming agent A food additive that is used to make or keep fruit or vegetable tissues firm and crisp. or which interacts with gelling agents such as pectin to produce or strengthen a gel. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). fertilizer A fertilizer is any substance that is added to soil or water to assist the growth of plants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcium carbonate (CHEBI:3311) has role antacid (CHEBI:65265) |
| calcium carbonate (CHEBI:3311) has role fertilizer (CHEBI:33287) |
| calcium carbonate (CHEBI:3311) has role food colouring (CHEBI:77182) |
| calcium carbonate (CHEBI:3311) has role food firming agent (CHEBI:77960) |
| calcium carbonate (CHEBI:3311) is a calcium salt (CHEBI:35156) |
| calcium carbonate (CHEBI:3311) is a carbonate salt (CHEBI:46721) |
| calcium carbonate (CHEBI:3311) is a inorganic calcium salt (CHEBI:190295) |
| calcium carbonate (CHEBI:3311) is a one-carbon compound (CHEBI:64708) |
| Incoming Relation(s) |
| aragonite (CHEBI:52239) is a calcium carbonate (CHEBI:3311) |
| calcite (CHEBI:46719) is a calcium carbonate (CHEBI:3311) |
| vaterite (CHEBI:52241) is a calcium carbonate (CHEBI:3311) |
| IUPAC Names |
|---|
| calcium carbonate |
| calcium trioxidocarbonate |
| Synonyms | Source |
|---|---|
| CaCO3 | IUPAC |
| Calciumcarbonat | ChEBI |
| Calcium carbonate | KEGG COMPOUND |
| calcium carbonate (1:1) | ChemIDplus |
| carbonate de calcium | ChEBI |
| carbonato de calcio | ChEBI |