EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:33094 - (S)-3-aminoisobutyric acid
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | C[C@@H](CN)C(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | QCHPKSFMDHPSNR-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-aminoisobutyric acid (CHEBI:33094) has role human metabolite (CHEBI:77746) |
| (S)-3-aminoisobutyric acid (CHEBI:33094) is a 3-aminoisobutyric acid (CHEBI:27389) |
| (S)-3-aminoisobutyric acid (CHEBI:33094) is a β-amino acid (CHEBI:33706) |
| (S)-3-aminoisobutyric acid (CHEBI:33094) is conjugate acid of (S)-3-aminoisobutyrate (CHEBI:18188) |
| (S)-3-aminoisobutyric acid (CHEBI:33094) is enantiomer of (R)-3-aminoisobutyric acid (CHEBI:16320) |
| (S)-3-aminoisobutyric acid (CHEBI:33094) is tautomer of (S)-3-aminoisobutyric acid zwitterion (CHEBI:58655) |
| Incoming Relation(s) |
| (S)-3-aminoisobutyrate (CHEBI:18188) is conjugate base of (S)-3-aminoisobutyric acid (CHEBI:33094) |
| (R)-3-aminoisobutyric acid (CHEBI:16320) is enantiomer of (S)-3-aminoisobutyric acid (CHEBI:33094) |
| (S)-3-aminoisobutyric acid zwitterion (CHEBI:58655) is tautomer of (S)-3-aminoisobutyric acid (CHEBI:33094) |
| IUPAC Name |
|---|
| (2S)-3-amino-2-methylpropanoic acid |
| Synonyms | Source |
|---|---|
| (S)-3-amino-2-methylpropanoic acid | ChEBI |
| (S)-3-amino-isobutanoic acid | ChEBI |
| (S)-3-amino-isobutyric acid | ChEBI |
| L-3-amino-isobutanoic acid | ChEBI |
| L-3-amino-isobutyric acid | ChEBI |
| (S)-β-aminoisobutyric acid | ChEBI |