EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | C[C@H](CN)C(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1 |
| InChIKey | QCHPKSFMDHPSNR-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-aminoisobutyric acid (CHEBI:16320) is a 3-aminoisobutyric acid (CHEBI:27389) |
| (R)-3-aminoisobutyric acid (CHEBI:16320) is conjugate acid of (R)-3-aminoisobutyrate (CHEBI:49097) |
| (R)-3-aminoisobutyric acid (CHEBI:16320) is enantiomer of (S)-3-aminoisobutyric acid (CHEBI:33094) |
| (R)-3-aminoisobutyric acid (CHEBI:16320) is tautomer of (R)-3-aminoisobutyric acid zwitterion (CHEBI:57731) |
| Incoming Relation(s) |
| (R)-3-aminoisobutyrate (CHEBI:49097) is conjugate base of (R)-3-aminoisobutyric acid (CHEBI:16320) |
| (S)-3-aminoisobutyric acid (CHEBI:33094) is enantiomer of (R)-3-aminoisobutyric acid (CHEBI:16320) |
| (R)-3-aminoisobutyric acid zwitterion (CHEBI:57731) is tautomer of (R)-3-aminoisobutyric acid (CHEBI:16320) |
| IUPAC Name |
|---|
| (2R)-3-amino-2-methylpropanoic acid |
| Synonyms | Source |
|---|---|
| (R)-3-Amino-2-methylpropanoate | KEGG COMPOUND |
| (R)-3-amino-2-methylpropanoate | ChEBI |
| (R)-β-aminoisobutyric acid | ChEBI |
| D-3-Amino-isobutanoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01205 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1720957 | Beilstein |
| Reaxys:1720957 | Reaxys |