EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:33082 - phenalene
| Formula | C13H10 |
| Net Charge | 0 |
| Average Mass | 166.223 |
| Monoisotopic Mass | 166.07825 |
| SMILES | C1=Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C13H10/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12/h1-8H,9H2 |
| InChIKey | XDJOIMJURHQYDW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenalene (CHEBI:33082) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| phenalene (CHEBI:33082) is a ortho- and peri-fused tricyclic hydrocarbon (CHEBI:51120) |
| Incoming Relation(s) |
| 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one (CHEBI:142620) has parent hydride phenalene (CHEBI:33082) |
| funalenone (CHEBI:65932) has parent hydride phenalene (CHEBI:33082) |
| IUPAC Name |
|---|
| 1H-phenalene |
| Synonyms | Source |
|---|---|
| phenalene | ChemIDplus |
| perinaphthene | NIST Chemistry WebBook |
| 1H-benzonaphthene | NIST Chemistry WebBook |