EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O6 |
| Net Charge | 0 |
| Average Mass | 274.228 |
| Monoisotopic Mass | 274.04774 |
| SMILES | Cc1cc(O)c2c3c(c(O)cc(O)c13)C(=O)C(O)=C2O |
| InChI | InChI=1S/C14H10O6/c1-4-2-5(15)9-11-8(4)6(16)3-7(17)10(11)13(19)14(20)12(9)18/h2-3,15-18,20H,1H3 |
| InChIKey | WKCIPEFSZITGMF-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one (CHEBI:142620) has parent hydride phenalene (CHEBI:33082) |
| 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one (CHEBI:142620) is a carbotricyclic compound (CHEBI:38032) |
| 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one (CHEBI:142620) is a enone (CHEBI:51689) |
| 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one (CHEBI:142620) is a phenols (CHEBI:33853) |
| 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one (CHEBI:142620) is conjugate acid of 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one(1−) (CHEBI:142788) |
| Incoming Relation(s) |
| 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one(1−) (CHEBI:142788) is conjugate base of 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one (CHEBI:142620) |
| IUPAC Name |
|---|
| 2,3,4,7,9-pentahydroxy-6-methyl-1H-phenalen-1-one |
| Citations |
|---|