EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:33016 - L-synephrine
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | CNC[C@@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3/t9-/m1/s1 |
| InChIKey | YRCWQPVGYLYSOX-SECBINFHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-synephrine (CHEBI:33016) is a synephrine (CHEBI:29081) |
| IUPAC Name |
|---|
| 4-[(1S)-1-hydroxy-2-(methylamino)ethyl]phenol |
| Synonyms | Source |
|---|---|
| (+)-Synephrine | ChemIDplus |
| (+)-p-hydroxy-α-[(methylamino)methyl]benzyl alcohol | ChemIDplus |
| (+)-p-Synephrine | ChemIDplus |
| (S)-4-hydroxy-α-[(methylamino)methyl]benzenemethanol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3198817 | Beilstein |
| Beilstein:6055501 | Beilstein |
| CAS:532-80-9 | ChemIDplus |