EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29081 - synephrine
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | CNCC(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3 |
| InChIKey | YRCWQPVGYLYSOX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| synephrine (CHEBI:29081) has role plant metabolite (CHEBI:76924) |
| synephrine (CHEBI:29081) has role α-adrenergic agonist (CHEBI:35569) |
| synephrine (CHEBI:29081) is a ethanolamines (CHEBI:23981) |
| synephrine (CHEBI:29081) is a phenethylamine alkaloid (CHEBI:38605) |
| synephrine (CHEBI:29081) is a phenols (CHEBI:33853) |
| synephrine (CHEBI:29081) is conjugate base of synephrinium (CHEBI:58606) |
| Incoming Relation(s) |
| D-synephrine (CHEBI:119) is a synephrine (CHEBI:29081) |
| L-synephrine (CHEBI:33016) is a synephrine (CHEBI:29081) |
| synephrinium (CHEBI:58606) is conjugate acid of synephrine (CHEBI:29081) |
| IUPAC Name |
|---|
| 1-(4-hydroxyphenyl)-2-(methylamino)ethanol |
| Synonyms | Source |
|---|---|
| 1-(4-Hydroxyphenyl)-2-(methylamino)ethanol | KEGG COMPOUND |
| β-methylamino-α-(4-hydroxyphenyl)ethyl alcohol | ChemIDplus |
| p-hydroxy-α-[(methylamino)methyl]benzyl alcohol | ChemIDplus |
| Oxedrine | ChemIDplus |
| Synephrine | ChemIDplus |
| 1-(4-hydroxyphenyl)-2-methylaminoethanol | ChemIDplus |
| Citations |
|---|