EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29081 - synephrine
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | CNCC(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3 |
| InChIKey | YRCWQPVGYLYSOX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| synephrine (CHEBI:29081) has role plant metabolite (CHEBI:76924) |
| synephrine (CHEBI:29081) has role α-adrenergic agonist (CHEBI:35569) |
| synephrine (CHEBI:29081) is a ethanolamines (CHEBI:23981) |
| synephrine (CHEBI:29081) is a phenethylamine alkaloid (CHEBI:38605) |
| synephrine (CHEBI:29081) is a phenols (CHEBI:33853) |
| synephrine (CHEBI:29081) is conjugate base of synephrinium (CHEBI:58606) |
| Incoming Relation(s) |
| D-synephrine (CHEBI:119) is a synephrine (CHEBI:29081) |
| L-synephrine (CHEBI:33016) is a synephrine (CHEBI:29081) |
| synephrinium (CHEBI:58606) is conjugate acid of synephrine (CHEBI:29081) |
| IUPAC Name |
|---|
| 1-(4-hydroxyphenyl)-2-(methylamino)ethanol |
| Synonyms | Source |
|---|---|
| 1-(4-hydroxyphenyl)-2-methylaminoethanol | ChemIDplus |
| 1-(4-Hydroxyphenyl)-2-(methylamino)ethanol | KEGG COMPOUND |
| 1-(4-Hydroxyphenyl)-2-(methylamino)ethanol | KEGG COMPOUND |
| 4-hydroxy-α-[(methylamino)methyl]benzenemethanol | ChemIDplus |
| p-hydroxy-α-[(methylamino)methyl]benzyl alcohol | ChemIDplus |
| Oxedrine | ChemIDplus |
| Citations |
|---|