EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H3O2.Na |
| Net Charge | 0 |
| Average Mass | 82.034 |
| Monoisotopic Mass | 82.00307 |
| SMILES | CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| InChIKey | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium acetate (CHEBI:32954) has part acetate (CHEBI:30089) |
| sodium acetate (CHEBI:32954) has role antineoplastic agent (CHEBI:35610) |
| sodium acetate (CHEBI:32954) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| sodium acetate trihydrate (CHEBI:32138) has part sodium acetate (CHEBI:32954) |
| IUPAC Name |
|---|
| sodium acetate |
| Synonyms | Source |
|---|---|
| acetic acid, sodium salt | ChemIDplus |
| Acetic acid, sodium salt (1:1) | ChEMBL |
| anhydrous sodium acetate | ChemIDplus |
| E262 | ChEMBL |
| E-262(I) | ChEMBL |
| FEMA NO. 3024 | ChEMBL |
| Brand Name | Source |
|---|---|
| Sodium acetate component of procalamine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| Sodium_Acetate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:20502 | Gmelin |
| Beilstein:3595639 | Beilstein |
| CAS:127-09-3 | ChemIDplus |
| Citations |
|---|