EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8NO3 |
| Net Charge | -1 |
| Average Mass | 118.112 |
| Monoisotopic Mass | 118.05097 |
| SMILES | C[C@H](O)[C@@H](N)C(=O)[O-] |
| InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/p-1/t2-,3+/m0/s1 |
| InChIKey | AYFVYJQAPQTCCC-STHAYSLISA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (15375647) |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-threoninate (CHEBI:32827) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| D-threoninate (CHEBI:32827) is a threoninate (CHEBI:32832) |
| D-threoninate (CHEBI:32827) is conjugate base of D-threonine (CHEBI:16398) |
| D-threoninate (CHEBI:32827) is enantiomer of L-threoninate (CHEBI:32820) |
| Incoming Relation(s) |
| D-threonine (CHEBI:16398) is conjugate acid of D-threoninate (CHEBI:32827) |
| L-threoninate (CHEBI:32820) is enantiomer of D-threoninate (CHEBI:32827) |
| IUPAC Name |
|---|
| D-threoninate |
| Synonyms | Source |
|---|---|
| (2R,3S)-2-amino-3-hydroxybutanoate | IUPAC |
| D-threonine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1006174 | Gmelin |