EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32820 - L-threoninate
| Formula | C4H8NO3 |
| Net Charge | -1 |
| Average Mass | 118.112 |
| Monoisotopic Mass | 118.05097 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/p-1/t2-,3+/m1/s1 |
| InChIKey | AYFVYJQAPQTCCC-GBXIJSLDSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (22289691) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (4616942) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-threoninate (CHEBI:32820) has role Escherichia coli metabolite (CHEBI:76971) |
| L-threoninate (CHEBI:32820) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-threoninate (CHEBI:32820) has role plant metabolite (CHEBI:76924) |
| L-threoninate (CHEBI:32820) is a L-α-amino acid anion (CHEBI:59814) |
| L-threoninate (CHEBI:32820) is a threoninate (CHEBI:32832) |
| L-threoninate (CHEBI:32820) is conjugate base of L-threonine (CHEBI:16857) |
| L-threoninate (CHEBI:32820) is enantiomer of D-threoninate (CHEBI:32827) |
| Incoming Relation(s) |
| L-threonine (CHEBI:16857) is conjugate acid of L-threoninate (CHEBI:32820) |
| D-threoninate (CHEBI:32827) is enantiomer of L-threoninate (CHEBI:32820) |
| IUPAC Name |
|---|
| L-threoninate |
| Synonyms | Source |
|---|---|
| (2S,3R)-2-amino-3-hydroxybutanoate | IUPAC |
| L-threonine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4376295 | Reaxys |
| Gmelin:464365 | Gmelin |