EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H42ClN3O13 |
| Net Charge | 0 |
| Average Mass | 844.270 |
| Monoisotopic Mass | 843.24062 |
| SMILES | [H][C@@]1(O[C@]23C=CC=C2C#C/C2=C\C#C[C@@]3([H])Oc3c(O)cc(cc3Cl)[C@@H](N)CC(=O)OC[C@@H]2OC(=O)c2cc(OC)cc3c2NC(=O)C(=C)O3)OC(C)(C)[C@@H](N(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C43H42ClN3O13/c1-21-39(52)46-34-26(17-25(54-6)18-30(34)56-21)40(53)57-31-20-55-33(49)19-28(45)23-15-27(44)37(29(48)16-23)58-32-11-7-9-22(31)12-13-24-10-8-14-43(24,32)60-41-36(51)35(50)38(47(4)5)42(2,3)59-41/h8-10,14-18,28,31-32,35-36,38,41,48,50-51H,1,19-20,45H2,2-6H3,(H,46,52)/b22-9+/t28-,31-,32+,35-,36+,38-,41-,43+/m0/s1 |
| InChIKey | DGGZCXUXASNDAC-QQNGCVSVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces globisporus (ncbitaxon:1908) | |||
| - | PubMed (21250756) | Strain: SB 1022 | |
| - | PubMed (21250756) | ||
| - | PubMed (21250756) | Strain: SB 1021 | |
| - | PubMed (21250756) | Strain: SB 1023 | |
| - | PubMed (21250756) | Strain: SB 1014 | |
| Streptomyces globisporus C-1027 (ncbitaxon:1172567) | - | PubMed (3198491) | |
| Streptomyces sp. CB00657 (ncbitaxon:1718958) | - | PubMed (29345939) | |
| Streptomyces sp. CB02329 (ncbitaxon:171897) | - | PubMed (29345939) | |
| Streptomyces sp. CB02366 (ncbitaxon:1703935) | - | PubMed (29345939) | |
| Streptomyces sp. CB03608 (ncbitaxon:1718988) | - | PubMed (29345939) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C-1027 chromophore (CHEBI:3252) has role antimicrobial agent (CHEBI:33281) |
| C-1027 chromophore (CHEBI:3252) has role antineoplastic agent (CHEBI:35610) |
| C-1027 chromophore (CHEBI:3252) has role apoptosis inducer (CHEBI:68495) |
| C-1027 chromophore (CHEBI:3252) has role bacterial metabolite (CHEBI:76969) |
| C-1027 chromophore (CHEBI:3252) is a amino sugar (CHEBI:28963) |
| C-1027 chromophore (CHEBI:3252) is a aromatic ether (CHEBI:35618) |
| C-1027 chromophore (CHEBI:3252) is a benzoxazine (CHEBI:46969) |
| C-1027 chromophore (CHEBI:3252) is a diester (CHEBI:51307) |
| C-1027 chromophore (CHEBI:3252) is a enediyne antibiotic (CHEBI:53268) |
| C-1027 chromophore (CHEBI:3252) is a monochlorobenzenes (CHEBI:83403) |
| C-1027 chromophore (CHEBI:3252) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| [1R,7S,12R,13(23)E,20R]-7-amino-4-chloro-20-{[(2S,3R,4R,5S)-5-(dimethylamino)-3,4-dihydroxy-6,6-dimethyltetrahydro-2H-pyran-2-yl]oxy}-25-hydroxy-9-oxo-2,10-dioxatetracyclo[11.7.3.23,6.016,20]pentacosa-3,5,13(23),16,18,24-hexaene-14,21-diyn-12-yl 7-methoxy-2-methylidene-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-5-carboxylate |
| Synonyms | Source |
|---|---|
| antibiotic C-1027 | ChemIDplus |
| C 1027 | ChemIDplus |
| C-1027 | KEGG COMPOUND |
| C-1027 chromophore | KEGG COMPOUND |
| C1027 chromophore | ChemIDplus |
| C1027 chromoprotein | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:120177-69-7 | ChemIDplus |
| Citations |
|---|