EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4NO2 |
| Net Charge | -1 |
| Average Mass | 74.059 |
| Monoisotopic Mass | 74.02475 |
| SMILES | NCC(=O)[O-] |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/p-1 |
| InChIKey | DHMQDGOQFOQNFH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycinate (CHEBI:32508) has role fundamental metabolite (CHEBI:78675) |
| glycinate (CHEBI:32508) is a α-amino-acid anion (CHEBI:33558) |
| glycinate (CHEBI:32508) is conjugate base of glycine (CHEBI:15428) |
| Incoming Relation(s) |
| N-acylglycinate (CHEBI:57670) has functional parent glycinate (CHEBI:32508) |
| glycine (CHEBI:15428) is conjugate acid of glycinate (CHEBI:32508) |
| glycino(1−) group (CHEBI:83148) is substituent group from glycinate (CHEBI:32508) |
| IUPAC Name |
|---|
| glycinate |
| Synonyms | Source |
|---|---|
| aminoacetate | IUPAC |
| glycine anion | JCBN |
| H2N‒CH2‒COO− | IUPAC |
| gly− | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| c0559 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| Gmelin:81890 | Gmelin |
| Reaxys:1852023 | Reaxys |