EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H6NO2 |
| Net Charge | +1 |
| Average Mass | 76.075 |
| Monoisotopic Mass | 76.03930 |
| SMILES | [NH3+]CC(=O)O |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/p+1 |
| InChIKey | DHMQDGOQFOQNFH-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycinium (CHEBI:32507) has role fundamental metabolite (CHEBI:78675) |
| glycinium (CHEBI:32507) is a α-amino-acid cation (CHEBI:33719) |
| glycinium (CHEBI:32507) is conjugate acid of glycine (CHEBI:15428) |
| Incoming Relation(s) |
| glycine (CHEBI:15428) is conjugate base of glycinium (CHEBI:32507) |
| glyciniumyl group (CHEBI:64723) is substituent group from glycinium (CHEBI:32507) |
| IUPAC Name |
|---|
| glycinium |
| Synonyms | Source |
|---|---|
| carboxymethanaminium | IUPAC |
| glycine cation | JCBN |
| H2gly+ | IUPAC |
| NH3+‒CH2‒COOH | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:323509 | Gmelin |