EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2 |
| Net Charge | 0 |
| Average Mass | 198.269 |
| Monoisotopic Mass | 198.11570 |
| SMILES | Nc1ccc(Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C13H14N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8H,9,14-15H2 |
| InChIKey | YBRVSVVVWCFQMG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-diaminodiphenylmethane (CHEBI:32506) has parent hydride diphenylmethane (CHEBI:38884) |
| 4,4'-diaminodiphenylmethane (CHEBI:32506) has role allergen (CHEBI:50904) |
| 4,4'-diaminodiphenylmethane (CHEBI:32506) has role carcinogenic agent (CHEBI:50903) |
| 4,4'-diaminodiphenylmethane (CHEBI:32506) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| 4,4'-methylenedianiline |
| Synonyms | Source |
|---|---|
| 4-(4-aminobenzyl)aniline | ChEMBL |
| 4,4'-Diaminodiphenylmethane | ChemIDplus |
| 4,4'-Diaminodiphenylmethane | KEGG COMPOUND |
| 4,4'-Diphenylmethanediamine | ChemIDplus |
| 4,4'-Methylenebis(benzeneamine) | ChemIDplus |
| 4,4'-methylenedianiline | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1640 | PPDB |
| 4,4'-Methylenedianiline | Wikipedia |
| C14288 | KEGG COMPOUND |
| HMDB0041808 | HMDB |
| Citations |
|---|