EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O15 |
| Net Charge | 0 |
| Average Mass | 596.538 |
| Monoisotopic Mass | 596.17412 |
| SMILES | O=C1C[C@@H](c2ccc(O)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)Oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc21 |
| InChI | InChI=1S/C27H32O15/c28-8-18-20(32)22(34)24(36)26(41-18)38-11-2-3-12-14(31)7-15(39-16(12)6-11)10-1-4-13(30)17(5-10)40-27-25(37)23(35)21(33)19(9-29)42-27/h1-6,15,18-30,32-37H,7-9H2/t15-,18+,19+,20+,21+,22-,23-,24+,25+,26+,27+/m0/s1 |
| InChIKey | QVCQYYYTMIZOGK-VQBAZXIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Butea monosperma (ncbitaxon:56060) | - | PubMed (20164300) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butrin (CHEBI:3244) has functional parent butin (CHEBI:27725) |
| butrin (CHEBI:3244) has role anti-inflammatory agent (CHEBI:67079) |
| butrin (CHEBI:3244) has role plant metabolite (CHEBI:76924) |
| butrin (CHEBI:3244) is a 4'-hydroxyflavanones (CHEBI:140331) |
| butrin (CHEBI:3244) is a flavanone glycoside (CHEBI:72730) |
| butrin (CHEBI:3244) is a monohydroxyflavanone (CHEBI:38748) |
| IUPAC Name |
|---|
| (2S)-2-[3-(β-D-glucopyranosyloxy)-4-hydroxyphenyl]-4-oxo-3,4-dihydro-2H-1-benzopyran-7-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Butin 7,3'-di-O-glucoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000946 | KNApSAcK |
| C09616 | KEGG COMPOUND |
| LMPK12140065 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10320972 | Reaxys |
| CAS:492-13-7 | KEGG COMPOUND |
| Citations |
|---|