EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | O=C1C[C@@H](c2ccc(O)c(O)c2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C15H12O5/c16-9-2-3-10-12(18)7-14(20-15(10)6-9)8-1-4-11(17)13(19)5-8/h1-6,14,16-17,19H,7H2/t14-/m0/s1 |
| InChIKey | MJBPUQUGJNAPAZ-AWEZNQCLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butin (CHEBI:27725) has role antioxidant (CHEBI:22586) |
| butin (CHEBI:27725) has role metabolite (CHEBI:25212) |
| butin (CHEBI:27725) has role protective agent (CHEBI:50267) |
| butin (CHEBI:27725) is a 4'-hydroxyflavanones (CHEBI:140331) |
| butin (CHEBI:27725) is a trihydroxyflavanone (CHEBI:38739) |
| Incoming Relation(s) |
| butrin (CHEBI:3244) has functional parent butin (CHEBI:27725) |
| IUPAC Name |
|---|
| (2S)-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 7,3',4'-Trihydroxyflavanone | KEGG COMPOUND |
| (−)-butin | ChEBI |
| (-)-Butin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C09614 | KEGG COMPOUND |
| Butin_(molecule) | Wikipedia |
| CN101559050 | Patent |
| CN101559051 | Patent |
| C00000945 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5289868 | Reaxys |
| CAS:492-14-8 | KEGG COMPOUND |
| CAS:492-14-8 | ChemIDplus |
| Citations |
|---|