EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29NO2.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 477.554 |
| Monoisotopic Mass | 477.23627 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)C(=O)O.Oc1ccc2c(c1)[C@@]13CCCC[C@@]1(O)[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C21H29NO2.C4H6O6/c23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15;5-1(3(7)8)2(6)4(9)10/h6-7,13,15,19,23-24H,1-5,8-12,14H2;1-2,5-6H,(H,7,8)(H,9,10)/t19-,20+,21-;1-,2-/m10/s1 |
| InChIKey | GMTYREVWZXJPLF-AFHUBHILSA-N |
| Roles Classification |
|---|
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butorphanol D-tartrate (CHEBI:3243) has part butorphanol (CHEBI:3242) |
| butorphanol D-tartrate (CHEBI:3243) has role opioid analgesic (CHEBI:35482) |
| butorphanol D-tartrate (CHEBI:3243) has role κ-opioid receptor agonist (CHEBI:59282) |
| butorphanol D-tartrate (CHEBI:3243) has role μ-opioid receptor agonist (CHEBI:55322) |
| butorphanol D-tartrate (CHEBI:3243) is a morphinane alkaloid (CHEBI:25418) |
| butorphanol D-tartrate (CHEBI:3243) is a tartrate salt (CHEBI:50562) |
| IUPAC Name |
|---|
| 17-(cyclobutylmethyl)morphinan-3,14-diol (2S,3S)-2,3-dihydroxybutanedioate |
| Synonyms | Source |
|---|---|
| (−)-17-(cyclobutylmethyl)morphinan-3,14-diol D-(−)-tartrate | ChemIDplus |
| 17-(cyclobutylmethyl)morphinan-3,14-diyl [S-(R*,R*)]-2,3-dihydroxysuccinate | ChemIDplus |
| butorphanol (S,S)-tartrate | ChEBI |
| butorphanol D-tartrate | ChEBI |
| butorphanol (−)-tartrate | ChEBI |
| (−)-N-cyclobutylmethyl-3,14-dihydroxymorphinan D-(−)-tartrate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5234837 | Beilstein |
| CAS:58786-99-5 | ChemIDplus |
| CAS:58786-99-5 | KEGG DRUG |