EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29NO2 |
| Net Charge | 0 |
| Average Mass | 327.468 |
| Monoisotopic Mass | 327.21983 |
| SMILES | Oc1ccc2c(c1)[C@@]13CCCC[C@@]1(O)[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C21H29NO2/c23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15/h6-7,13,15,19,23-24H,1-5,8-12,14H2/t19-,20+,21-/m1/s1 |
| InChIKey | IFKLAQQSCNILHL-QHAWAJNXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butorphanol (CHEBI:3242) has role antitussive (CHEBI:51177) |
| butorphanol (CHEBI:3242) has role opioid analgesic (CHEBI:35482) |
| butorphanol (CHEBI:3242) has role κ-opioid receptor agonist (CHEBI:59282) |
| butorphanol (CHEBI:3242) has role μ-opioid receptor agonist (CHEBI:55322) |
| butorphanol (CHEBI:3242) is a morphinane alkaloid (CHEBI:25418) |
| Incoming Relation(s) |
| butorphanol D-tartrate (CHEBI:3243) has part butorphanol (CHEBI:3242) |
| IUPAC Name |
|---|
| 17-(cyclobutylmethyl)morphinan-3,14-diol |
| INNs | Source |
|---|---|
| butorfanol | ChemIDplus |
| butorphanol | ChemIDplus |
| butorphanolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (−)-17-(cyclobutylmethyl)morphinan-3,14-diol | ChemIDplus |
| (−)-butorphanol | ChEBI |
| Butorphanol | KEGG COMPOUND |
| BUTORPHANOL | ChEMBL |
| (−)-N-cyclobutylmethyl-3,14-dihydroxymorphinan | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8134188 | Beilstein |
| CAS:42408-82-2 | ChemIDplus |
| CAS:42408-82-2 | KEGG COMPOUND |
| Citations |
|---|