EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30NO3.Cl |
| Net Charge | 0 |
| Average Mass | 427.972 |
| Monoisotopic Mass | 427.19142 |
| SMILES | [Cl-].[H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(O)(c3ccccc3)c3ccccc3)C1)[N+]21CCCC1 |
| InChI | InChI=1S/C25H30NO3.ClH/c27-24(25(28,19-9-3-1-4-10-19)20-11-5-2-6-12-20)29-23-17-21-13-14-22(18-23)26(21)15-7-8-16-26;/h1-6,9-12,21-23,28H,7-8,13-18H2;1H/q+1;/p-1/t21-,22+,23+; |
| InChIKey | RVCSYOQWLPPAOA-QKYUOBHYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trospium chloride (CHEBI:32270) has part trospium (CHEBI:145791) |
| trospium chloride (CHEBI:32270) has role antispasmodic drug (CHEBI:53784) |
| trospium chloride (CHEBI:32270) has role muscarinic antagonist (CHEBI:48876) |
| trospium chloride (CHEBI:32270) is a organic chloride salt (CHEBI:36094) |
| trospium chloride (CHEBI:32270) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (1S,3R,5R)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-8λ5-azaspiro[bicyclo[3.2.1]octane-8,1'-pyrrolidin]-8-ylium chloride |
| INNs | Source |
|---|---|
| chlorure de trospium | WHO MedNet |
| cloruro de trospio | WHO MedNet |
| trospii chloridum | WHO MedNet |
| trospium chloride | WHO MedNet |
| Synonyms | Source |
|---|---|
| IP-631 | ChEBI |
| IP631 | ChemIDplus |
| Trospium chloride | KEGG DRUG |
| trospium Cl | ChemIDplus |
| Brand Names | Source |
|---|---|
| Regurin | ChEBI |
| Relaspium | ChemIDplus |
| Sanctura | ChemIDplus |
| Sanctura XR | ChemIDplus |
| Santura | ChemIDplus |
| Spasmed | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2776 | DrugCentral |
| D01103 | KEGG DRUG |
| DBSALT000883 | DrugBank |
| Trospium_chloride | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:10405-02-4 | ChemIDplus |
| Citations |
|---|