EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30NO3.Cl |
| Net Charge | 0 |
| Average Mass | 427.972 |
| Monoisotopic Mass | 427.19142 |
| SMILES | [Cl-].[H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(O)(c3ccccc3)c3ccccc3)C1)[N+]21CCCC1 |
| InChI | InChI=1S/C25H30NO3.ClH/c27-24(25(28,19-9-3-1-4-10-19)20-11-5-2-6-12-20)29-23-17-21-13-14-22(18-23)26(21)15-7-8-16-26;/h1-6,9-12,21-23,28H,7-8,13-18H2;1H/q+1;/p-1/t21-,22+,23+; |
| InChIKey | RVCSYOQWLPPAOA-QKYUOBHYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trospium chloride (CHEBI:32270) has part trospium (CHEBI:145791) |
| trospium chloride (CHEBI:32270) has role antispasmodic drug (CHEBI:53784) |
| trospium chloride (CHEBI:32270) has role muscarinic antagonist (CHEBI:48876) |
| trospium chloride (CHEBI:32270) is a organic chloride salt (CHEBI:36094) |
| trospium chloride (CHEBI:32270) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (1S,3R,5R)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-8λ5-azaspiro[bicyclo[3.2.1]octane-8,1'-pyrrolidin]-8-ylium chloride |
| INNs | Source |
|---|---|
| trospium chloride | WHO MedNet |
| cloruro de trospio | WHO MedNet |
| chlorure de trospium | WHO MedNet |
| trospii chloridum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Trospium chloride | KEGG DRUG |
| IP631 | ChemIDplus |
| IP-631 | ChEBI |
| trospium Cl | ChemIDplus |
| Brand Names | Source |
|---|---|
| Spasmoplex | KEGG DRUG |
| Spasmex | KEGG DRUG |
| Sanctura | ChemIDplus |
| Sanctura XR | ChemIDplus |
| Trosec | DrugBank |
| Uraplex | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01103 | KEGG DRUG |
| 2776 | DrugCentral |
| DBSALT000883 | DrugBank |
| Trospium_chloride | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:10405-02-4 | ChemIDplus |
| Citations |
|---|