EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30NO3 |
| Net Charge | +1 |
| Average Mass | 392.519 |
| Monoisotopic Mass | 392.22202 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](OC(=O)C(O)(c3ccccc3)c3ccccc3)C1)[N+]21CCCC1 |
| InChI | InChI=1S/C25H30NO3/c27-24(25(28,19-9-3-1-4-10-19)20-11-5-2-6-12-20)29-23-17-21-13-14-22(18-23)26(21)15-7-8-16-26/h1-6,9-12,21-23,28H,7-8,13-18H2/q+1/t21-,22+,23+ |
| InChIKey | OYYDSUSKLWTMMQ-JKHIJQBDSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. renal agent A drug used for its effect on the kidneys' regulation of body fluid composition and volume. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trospium (CHEBI:145791) has role antispasmodic drug (CHEBI:53784) |
| trospium (CHEBI:145791) has role muscarinic antagonist (CHEBI:48876) |
| trospium (CHEBI:145791) has role renal agent (CHEBI:35846) |
| trospium (CHEBI:145791) is a azabicycloalkane (CHEBI:38295) |
| trospium (CHEBI:145791) is a carboxylic ester (CHEBI:33308) |
| trospium (CHEBI:145791) is a quaternary ammonium ion (CHEBI:35267) |
| trospium (CHEBI:145791) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| trospium chloride (CHEBI:32270) has part trospium (CHEBI:145791) |
| IUPAC Name |
|---|
| (1S,3R,5R)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-8λ5-azaspiro[bicyclo[3.2.1]octane-8,1'-pyrrolidin]-8-ylium |
| Synonyms | Source |
|---|---|
| (1α,3β,5α)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-pyrrolidinium] | ChEBI |
| tropsium cation | ChemIDplus |
| tropsium ion | ChEBI |
| Trospium | ChEMBL |
| Trospium cation | ChEMBL |
| Trospium ion | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2776 | DrugCentral |
| DB00209 | DrugBank |
| HMDB0014354 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:47608-32-2 | ChemIDplus |
| Citations |
|---|