EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C19H24NS2 |
| Net Charge | 0 |
| Average Mass | 410.446 |
| Monoisotopic Mass | 409.05335 |
| SMILES | [Br-].[H][C@]12CCCC[N@+]1(C)CC(=C(c1cccs1)c1cccs1)CC2 |
| InChI | InChI=1S/C19H24NS2.BrH/c1-20-11-3-2-6-16(20)10-9-15(14-20)19(17-7-4-12-21-17)18-8-5-13-22-18;/h4-5,7-8,12-13,16H,2-3,6,9-11,14H2,1H3;1H/q+1;/p-1/t16-,20-;/m1./s1 |
| InChIKey | VKBNGRDAHSELMQ-KYSFMIDTSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiquizium bromide (CHEBI:32232) has part tiquizium (CHEBI:145714) |
| tiquizium bromide (CHEBI:32232) has role anti-ulcer drug (CHEBI:49201) |
| tiquizium bromide (CHEBI:32232) has role antispasmodic drug (CHEBI:53784) |
| tiquizium bromide (CHEBI:32232) has role muscarinic antagonist (CHEBI:48876) |
| tiquizium bromide (CHEBI:32232) is a organic bromide salt (CHEBI:48369) |
| tiquizium bromide (CHEBI:32232) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (5R,9aR)-3-[di(thiophen-2-yl)methylidene]-5-methyloctahydro-2H-quinolizinium bromide |
| INNs | Source |
|---|---|
| tiquizium bromide | WHO MedNet |
| bromuro de tiquizio | WHO MedNet |
| bromure de tiquizium | WHO MedNet |
| tiquizii bromidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| HSR 902 | ChEBI |
| HSR-902 | ChemIDplus |
| (5R,9aR)-3-[di(thiophen-2-yl)methylidene]-5-methyloctahydro-2H-quinolizin-5-ium bromide | IUPAC |
| 3-(di(2-thienyl)methylene)-5-methyldecahydroquinolizinium bromide | ChemIDplus |
| trans-3-(di-2-thienylmethylene)octahydro-5-methyl-2H-quinolizinium bromide | ChemIDplus |
| 3-(di-2-thienylmethylene)-5-methyl-trans-quinolizidinium bromide | ChEBI |
| Brand Names | Source |
|---|---|
| Thiaton | KEGG DRUG |
| Tiapaston | ChEBI |
| Thiameron | ChEBI |
| Gastirol | ChEBI |
| Advaston | ChEBI |
| Thiwan | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:71731-58-3 | ChemIDplus |
| Citations |
|---|