EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3223 - buspirone
| Formula | C21H31N5O2 |
| Net Charge | 0 |
| Average Mass | 385.512 |
| Monoisotopic Mass | 385.24778 |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H31N5O2/c27-18-16-21(6-1-2-7-21)17-19(28)26(18)11-4-3-10-24-12-14-25(15-13-24)20-22-8-5-9-23-20/h5,8-9H,1-4,6-7,10-17H2 |
| InChIKey | QWCRAEMEVRGPNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buspirone (CHEBI:3223) has role anxiolytic drug (CHEBI:35474) |
| buspirone (CHEBI:3223) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| buspirone (CHEBI:3223) has role sedative (CHEBI:35717) |
| buspirone (CHEBI:3223) has role serotonergic agonist (CHEBI:35941) |
| buspirone (CHEBI:3223) is a N-alkylpiperazine (CHEBI:46845) |
| buspirone (CHEBI:3223) is a N-arylpiperazine (CHEBI:46848) |
| buspirone (CHEBI:3223) is a azaspiro compound (CHEBI:35624) |
| buspirone (CHEBI:3223) is a organic heteropolycyclic compound (CHEBI:38166) |
| buspirone (CHEBI:3223) is a piperidones (CHEBI:48589) |
| buspirone (CHEBI:3223) is a pyrimidines (CHEBI:39447) |
| buspirone (CHEBI:3223) is conjugate base of buspirone(1+) (CHEBI:132102) |
| Incoming Relation(s) |
| buspirone(1+) (CHEBI:132102) is conjugate acid of buspirone (CHEBI:3223) |
| IUPAC Name |
|---|
| 8-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| INNs | Source |
|---|---|
| buspirona | WHO MedNet |
| buspirone | ChemIDplus |
| buspirone | WHO MedNet |
| buspironum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 8-(4-(4-(2-Pyrimidinyl)-1-piperizinyl)butyl)-8-azaspiro(4,5)decane-7,9-dione | ChemIDplus |
| Buspirone | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:964904 | Reaxys |
| CAS:36505-84-7 | KEGG COMPOUND |
| CAS:36505-84-7 | ChemIDplus |
| Citations |
|---|