EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N5O2 |
| Net Charge | +1 |
| Average Mass | 386.520 |
| Monoisotopic Mass | 386.25505 |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCCC[NH+]1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H31N5O2/c27-18-16-21(6-1-2-7-21)17-19(28)26(18)11-4-3-10-24-12-14-25(15-13-24)20-22-8-5-9-23-20/h5,8-9H,1-4,6-7,10-17H2/p+1 |
| InChIKey | QWCRAEMEVRGPNT-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buspirone(1+) (CHEBI:132102) is a ammonium ion derivative (CHEBI:35274) |
| buspirone(1+) (CHEBI:132102) is conjugate acid of buspirone (CHEBI:3223) |
| Incoming Relation(s) |
| buspirone hydrochloride (CHEBI:3224) has part buspirone(1+) (CHEBI:132102) |
| buspirone (CHEBI:3223) is conjugate base of buspirone(1+) (CHEBI:132102) |
| IUPAC Name |
|---|
| 1-[4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butyl]-4-(pyrimidin-2-yl)piperazin-1-ium |