EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1 |
| InChIKey | WHBMMWSBFZVSSR-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annulohypoxylon truncatum (ncbitaxon:327061) | - | PubMed (14695807) | |
| Linyphia triangularis (ncbitaxon:94031) | - | PubMed (17810206) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-hydroxybutyric acid (CHEBI:17066) has role fungal metabolite (CHEBI:76946) |
| (R)-3-hydroxybutyric acid (CHEBI:17066) has role human metabolite (CHEBI:77746) |
| (R)-3-hydroxybutyric acid (CHEBI:17066) has role pheromone (CHEBI:26013) |
| (R)-3-hydroxybutyric acid (CHEBI:17066) is a 3-hydroxybutyric acid (CHEBI:20067) |
| (R)-3-hydroxybutyric acid (CHEBI:17066) is a ketone body (CHEBI:73693) |
| (R)-3-hydroxybutyric acid (CHEBI:17066) is conjugate acid of (R)-3-hydroxybutyrate (CHEBI:10983) |
| (R)-3-hydroxybutyric acid (CHEBI:17066) is enantiomer of (S)-3-hydroxybutyric acid (CHEBI:17290) |
| Incoming Relation(s) |
| (R)-3-hydroxybutanoyl-CoA (CHEBI:15452) has functional parent (R)-3-hydroxybutyric acid (CHEBI:17066) |
| (3R)-3-hydroxybutanoic acid oligomer (CHEBI:140392) has functional parent (R)-3-hydroxybutyric acid (CHEBI:17066) |
| ascr#11 (CHEBI:78743) has functional parent (R)-3-hydroxybutyric acid (CHEBI:17066) |
| ethyl (R)-3-hydroxybutanoate (CHEBI:28707) has functional parent (R)-3-hydroxybutyric acid (CHEBI:17066) |
| (R)-3-hydroxybutyrate (CHEBI:10983) is conjugate base of (R)-3-hydroxybutyric acid (CHEBI:17066) |
| (S)-3-hydroxybutyric acid (CHEBI:17290) is enantiomer of (R)-3-hydroxybutyric acid (CHEBI:17066) |
| IUPAC Name |
|---|
| (3R)-3-hydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| 3-D-hydroxybutyric acid | ChEBI |
| (R)-(-)-β-hydroxybutyric acid | ChEBI |
| (R)-3-Hydroxybutanoic acid | KEGG COMPOUND |
| (R)-3-Hydroxybutyric acid | KEGG COMPOUND |
| D-3-hydroxybutyric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01089 | KEGG COMPOUND |
| CPD-335 | MetaCyc |
| HMDB0000011 | HMDB |
| LMFA01050243 | LIPID MAPS |
| WO9312254 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720568 | Reaxys |
| CAS:625-72-9 | KEGG COMPOUND |
| CAS:625-72-9 | ChemIDplus |
| Citations |
|---|