EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CCOC(=O)C[C@@H](C)O |
| InChI | InChI=1S/C6H12O3/c1-3-9-6(8)4-5(2)7/h5,7H,3-4H2,1-2H3/t5-/m1/s1 |
| InChIKey | OMSUIQOIVADKIM-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl (R)-3-hydroxybutanoate (CHEBI:28707) has functional parent (R)-3-hydroxybutyric acid (CHEBI:17066) |
| ethyl (R)-3-hydroxybutanoate (CHEBI:28707) is a ethyl 3-hydroxybutyrate (CHEBI:87685) |
| Synonyms | Source |
|---|---|
| Ethyl (R)-3-hydroxybutanoate | KEGG COMPOUND |
| ethyl (3R)-3-hydroxybutanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| ethyl (R)-3-hydroxybutanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03499 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1721368 | Beilstein |