EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N4O4S |
| Net Charge | 0 |
| Average Mass | 310.335 |
| Monoisotopic Mass | 310.07358 |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(N)cc2)nc(OC)n1 |
| InChI | InChI=1S/C12H14N4O4S/c1-19-11-7-10(14-12(15-11)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | ZZORFUFYDOWNEF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfadimethoxine (CHEBI:32161) has functional parent sulfanilamide (CHEBI:45373) |
| sulfadimethoxine (CHEBI:32161) has role antiinfective agent (CHEBI:35441) |
| sulfadimethoxine (CHEBI:32161) has role antimicrobial agent (CHEBI:33281) |
| sulfadimethoxine (CHEBI:32161) has role drug allergen (CHEBI:88188) |
| sulfadimethoxine (CHEBI:32161) has role environmental contaminant (CHEBI:78298) |
| sulfadimethoxine (CHEBI:32161) has role xenobiotic (CHEBI:35703) |
| sulfadimethoxine (CHEBI:32161) is a aromatic ether (CHEBI:35618) |
| sulfadimethoxine (CHEBI:32161) is a pyrimidines (CHEBI:39447) |
| sulfadimethoxine (CHEBI:32161) is a substituted aniline (CHEBI:48975) |
| sulfadimethoxine (CHEBI:32161) is a sulfonamide (CHEBI:35358) |
| sulfadimethoxine (CHEBI:32161) is a sulfonamide antibiotic (CHEBI:87228) |
| IUPAC Name |
|---|
| 4-amino-N-(2,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfadimethoxinum | ChemIDplus |
| sulfadimetoxina | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,4-dimethoxy-6-sulfanilamido-1,3-diazine | ChemIDplus |
| 2,6-dimethoxy-4-(p-aminobenzenesulfonamido)pyrimidine | ChemIDplus |
| 2,6-dimethoxy-4-sulfanilamidopyrimidine | ChemIDplus |
| 4-amino-N-(2,6-dimethoxy-4-pyrimidinyl)benzenesulfonamide | ChemIDplus |
| 6-sulfanilamido-2,4-dimethoxypyrimidine | ChemIDplus |
| Abcid (TN) | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1833 | VSDB |
| 2501 | DrugCentral |
| D01142 | KEGG DRUG |
| DB06150 | DrugBank |
| HMDB0015621 | HMDB |
| LSM-5790 | LINCS |
| Sulfadimethoxine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:306856 | Reaxys |
| Gmelin:677830 | Gmelin |
| CAS:122-11-2 | ChemIDplus |
| CAS:122-11-2 | KEGG DRUG |
| Citations |
|---|